C13H16ClNO5S — CID 107090368
2-chloro-4-[4-(dimethylamino)-4-oxobutyl]sulfonylbenzoic acid (PubChem CID 107090368) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 2-chloro-4-[4-(dimethylamino)-4-oxobutyl]sulfonylbenzoic acid.
| Compound Name | 2-chloro-4-[4-(dimethylamino)-4-oxobutyl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107090368 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 2-chloro-4-[4-(dimethylamino)-4-oxobutyl]sulfonylbenzoic acid |
| SMILES | CN(C)C(=O)CCCS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO5S/c1-15(2)12(16)4-3-7-21(19,20)9-5-6-10(13(17)18)11(14)8-9/h5-6,8H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | ZQGZMFXFFQDCEX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |