C12H18N2O3S — CID 81180754
4-(3-aminophenyl)sulfonyl-N,N-dimethylbutanamide (PubChem CID 81180754) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-(3-aminophenyl)sulfonyl-N,N-dimethylbutanamide.
| Compound Name | 4-(3-aminophenyl)sulfonyl-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 81180754 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-(3-aminophenyl)sulfonyl-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCS(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C12H18N2O3S/c1-14(2)12(15)7-4-8-18(16,17)11-6-3-5-10(13)9-11/h3,5-6,9H,4,7-8,13H2,1-2H3 |
| InChIKey | ZFXANBYRANHGGD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|