C13H17ClO4S — CID 107090395
2-chloro-4-(3,3-dimethylbutylsulfonyl)benzoic acid (PubChem CID 107090395) has the molecular formula C13H17ClO4S and a molecular weight of 304.80 g/mol. Its IUPAC name is 2-chloro-4-(3,3-dimethylbutylsulfonyl)benzoic acid.
| Compound Name | 2-chloro-4-(3,3-dimethylbutylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 107090395 |
| Molecular Formula | C13H17ClO4S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-chloro-4-(3,3-dimethylbutylsulfonyl)benzoic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)c1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClO4S/c1-13(2,3)6-7-19(17,18)9-4-5-10(12(15)16)11(14)8-9/h4-5,8H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | CAIVJLSDZYBRGB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |