C14H10Cl2O4S — CID 107090467
2-chloro-4-[(4-chlorophenyl)methylsulfonyl]benzoic acid (PubChem CID 107090467) has the molecular formula C14H10Cl2O4S and a molecular weight of 345.20 g/mol. Its IUPAC name is 2-chloro-4-[(4-chlorophenyl)methylsulfonyl]benzoic acid.
| Compound Name | 2-chloro-4-[(4-chlorophenyl)methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 107090467 |
| Molecular Formula | C14H10Cl2O4S |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 2-chloro-4-[(4-chlorophenyl)methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C14H10Cl2O4S/c15-10-3-1-9(2-4-10)8-21(19,20)11-5-6-12(14(17)18)13(16)7-11/h1-7H,8H2,(H,17,18) |
| InChIKey | VZDLKQSRZGBTJE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |