C14H22N2O2S2 — CID 106920164
4-[2,2-dimethylpropyl(methyl)sulfamoyl]-2-methylbenzenecarbothioamide (PubChem CID 106920164) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 4-[2,2-dimethylpropyl(methyl)sulfamoyl]-2-methylbenzenecarbothioamide.
| Compound Name | 4-[2,2-dimethylpropyl(methyl)sulfamoyl]-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106920164 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-[2,2-dimethylpropyl(methyl)sulfamoyl]-2-methylbenzenecarbothioamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CC(C)(C)C)ccc1C(N)=S |
| InChI | InChI=1S/C14H22N2O2S2/c1-10-8-11(6-7-12(10)13(15)19)20(17,18)16(5)9-14(2,3)4/h6-8H,9H2,1-5H3,(H2,15,19) |
| InChIKey | XMMNWYBKMURHCD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|