C11H16N2O4S2 — CID 62143938
2-amino-N-cyclopropyl-N-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 62143938) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-N-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | 2-amino-N-cyclopropyl-N-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 62143938 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-amino-N-cyclopropyl-N-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | CN(C1CC1)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1N |
| InChI | InChI=1S/C11H16N2O4S2/c1-13(8-3-4-8)19(16,17)11-7-9(18(2,14)15)5-6-10(11)12/h5-8H,3-4,12H2,1-2H3 |
| InChIKey | IEVIPAXHWPLFFU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|