C11H16N2O4S2 — CID 47291841
4-N-(cyclopropylmethyl)-4-N-methylbenzene-1,4-disulfonamide (PubChem CID 47291841) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-N-(cyclopropylmethyl)-4-N-methylbenzene-1,4-disulfonamide.
| Compound Name | 4-N-(cyclopropylmethyl)-4-N-methylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 47291841 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-N-(cyclopropylmethyl)-4-N-methylbenzene-1,4-disulfonamide |
| SMILES | CN(CC1CC1)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-13(8-9-2-3-9)19(16,17)11-6-4-10(5-7-11)18(12,14)15/h4-7,9H,2-3,8H2,1H3,(H2,12,14,15) |
| InChIKey | YRCCRFUJHCYHSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |