C13H21N3O2S — CID 55248102
N-(cyclopentylmethyl)-4-hydrazinyl-N-methylbenzenesulfonamide (PubChem CID 55248102) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4-hydrazinyl-N-methylbenzenesulfonamide.
| Compound Name | N-(cyclopentylmethyl)-4-hydrazinyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55248102 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(cyclopentylmethyl)-4-hydrazinyl-N-methylbenzenesulfonamide |
| SMILES | CN(CC1CCCC1)S(=O)(=O)c1ccc(NN)cc1 |
| InChI | InChI=1S/C13H21N3O2S/c1-16(10-11-4-2-3-5-11)19(17,18)13-8-6-12(15-14)7-9-13/h6-9,11,15H,2-5,10,14H2,1H3 |
| InChIKey | FVPRAJFJTIQJBP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|