C12H15NO5S — CID 54876183
5-[cyclopropylmethyl(methyl)sulfamoyl]-2-hydroxybenzoic acid (PubChem CID 54876183) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 5-[cyclopropylmethyl(methyl)sulfamoyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[cyclopropylmethyl(methyl)sulfamoyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54876183 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5-[cyclopropylmethyl(methyl)sulfamoyl]-2-hydroxybenzoic acid |
| SMILES | CN(CC1CC1)S(=O)(=O)c1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H15NO5S/c1-13(7-8-2-3-8)19(17,18)9-4-5-11(14)10(6-9)12(15)16/h4-6,8,14H,2-3,7H2,1H3,(H,15,16) |
| InChIKey | ZYDJOASFNDXWQU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |