C13H20N2O2S2 — CID 106086279
5-(aminomethyl)-2,4-dimethyl-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 106086279) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-(aminomethyl)-2,4-dimethyl-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2,4-dimethyl-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106086279 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-(aminomethyl)-2,4-dimethyl-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC2CCSC2)cc1CN |
| InChI | InChI=1S/C13H20N2O2S2/c1-9-5-10(2)13(6-11(9)7-14)19(16,17)15-12-3-4-18-8-12/h5-6,12,15H,3-4,7-8,14H2,1-2H3 |
| InChIKey | BHOQYEYGUBQNCR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |