C14H17NO4S2 — CID 103064573
(E)-3-[4-methyl-3-(thiolan-3-ylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 103064573) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-3-[4-methyl-3-(thiolan-3-ylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methyl-3-(thiolan-3-ylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 103064573 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (E)-3-[4-methyl-3-(thiolan-3-ylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C14H17NO4S2/c1-10-2-3-11(4-5-14(16)17)8-13(10)21(18,19)15-12-6-7-20-9-12/h2-5,8,12,15H,6-7,9H2,1H3,(H,16,17)/b5-4+ |
| InChIKey | QCDPSXOHHKWHPA-SNAWJCMRSA-N |
| XLogP | 1.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|