C12H16ClFN2O2S2 — CID 106081545
3-(aminomethyl)-5-chloro-2-fluoro-N-(thian-3-yl)benzenesulfonamide (PubChem CID 106081545) has the molecular formula C12H16ClFN2O2S2 and a molecular weight of 338.86 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-2-fluoro-N-(thian-3-yl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-(thian-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106081545 |
| Molecular Formula | C12H16ClFN2O2S2 |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-(thian-3-yl)benzenesulfonamide |
| SMILES | NCc1cc(Cl)cc(S(=O)(=O)NC2CCCSC2)c1F |
| InChI | InChI=1S/C12H16ClFN2O2S2/c13-9-4-8(6-15)12(14)11(5-9)20(17,18)16-10-2-1-3-19-7-10/h4-5,10,16H,1-3,6-7,15H2 |
| InChIKey | PROZJLDMFSYNHY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |