C9H16N4O2S2 — CID 106081474
4-(aminomethyl)-N-(thian-3-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 106081474) has the molecular formula C9H16N4O2S2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(thian-3-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(thian-3-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106081474 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-(aminomethyl)-N-(thian-3-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | NCc1cn[nH]c1S(=O)(=O)NC1CCCSC1 |
| InChI | InChI=1S/C9H16N4O2S2/c10-4-7-5-11-12-9(7)17(14,15)13-8-2-1-3-16-6-8/h5,8,13H,1-4,6,10H2,(H,11,12) |
| InChIKey | MBWYZRCZBCRRQV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |