C13H24N4O2S — CID 106027691
4-(ethylaminomethyl)-N-(3-methylcyclohexyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106027691) has the molecular formula C13H24N4O2S and a molecular weight of 300.43 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(3-methylcyclohexyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(3-methylcyclohexyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106027691 |
| Molecular Formula | C13H24N4O2S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(3-methylcyclohexyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCNCc1cn[nH]c1S(=O)(=O)NC1CCCC(C)C1 |
| InChI | InChI=1S/C13H24N4O2S/c1-3-14-8-11-9-15-16-13(11)20(18,19)17-12-6-4-5-10(2)7-12/h9-10,12,14,17H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | LMVPJMVVSAIWFB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |