C11H20N4O2S2 — CID 106091522
4-(aminomethyl)-N-(3-ethylsulfanylcyclopentyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106091522) has the molecular formula C11H20N4O2S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(3-ethylsulfanylcyclopentyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(aminomethyl)-N-(3-ethylsulfanylcyclopentyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106091522 |
| Molecular Formula | C11H20N4O2S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 4-(aminomethyl)-N-(3-ethylsulfanylcyclopentyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CCSC1CCC(NS(=O)(=O)c2[nH]ncc2CN)C1 |
| InChI | InChI=1S/C11H20N4O2S2/c1-2-18-10-4-3-9(5-10)15-19(16,17)11-8(6-12)7-13-14-11/h7,9-10,15H,2-6,12H2,1H3,(H,13,14) |
| InChIKey | ATBZMESALXXDSS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |