C11H19N5O2S2 — CID 114123634
N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyrimidine-5-sulfonamide (PubChem CID 114123634) has the molecular formula C11H19N5O2S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyrimidine-5-sulfonamide.
| Compound Name | N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 114123634 |
| Molecular Formula | C11H19N5O2S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-(3-ethylsulfanylcyclopentyl)-2-hydrazinylpyrimidine-5-sulfonamide |
| SMILES | CCSC1CCC(NS(=O)(=O)c2cnc(NN)nc2)C1 |
| InChI | InChI=1S/C11H19N5O2S2/c1-2-19-9-4-3-8(5-9)16-20(17,18)10-6-13-11(15-12)14-7-10/h6-9,16H,2-5,12H2,1H3,(H,13,14,15) |
| InChIKey | JMWWEHNSVXLUKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|