C9H15N5O3S2 — CID 113480161
2-hydrazinyl-N-(1-oxothian-4-yl)pyrimidine-5-sulfonamide (PubChem CID 113480161) has the molecular formula C9H15N5O3S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1-oxothian-4-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(1-oxothian-4-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 113480161 |
| Molecular Formula | C9H15N5O3S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-hydrazinyl-N-(1-oxothian-4-yl)pyrimidine-5-sulfonamide |
| SMILES | NNc1ncc(S(=O)(=O)NC2CCS(=O)CC2)cn1 |
| InChI | InChI=1S/C9H15N5O3S2/c10-13-9-11-5-8(6-12-9)19(16,17)14-7-1-3-18(15)4-2-7/h5-7,14H,1-4,10H2,(H,11,12,13) |
| InChIKey | USKJHUFNYJXJJS-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|