C14H21NO2S2 — CID 113248074
N-(3-ethylsulfanylcyclopentyl)-2-methylbenzenesulfonamide (PubChem CID 113248074) has the molecular formula C14H21NO2S2 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-(3-ethylsulfanylcyclopentyl)-2-methylbenzenesulfonamide.
| Compound Name | N-(3-ethylsulfanylcyclopentyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113248074 |
| Molecular Formula | C14H21NO2S2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-(3-ethylsulfanylcyclopentyl)-2-methylbenzenesulfonamide |
| SMILES | CCSC1CCC(NS(=O)(=O)c2ccccc2C)C1 |
| InChI | InChI=1S/C14H21NO2S2/c1-3-18-13-9-8-12(10-13)15-19(16,17)14-7-5-4-6-11(14)2/h4-7,12-13,15H,3,8-10H2,1-2H3 |
| InChIKey | HFWMSECSTKNYTP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |