C12H18N2O2S4 — CID 106272138
5-[(3-ethylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106272138) has the molecular formula C12H18N2O2S4 and a molecular weight of 350.56 g/mol. Its IUPAC name is 5-[(3-ethylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(3-ethylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106272138 |
| Molecular Formula | C12H18N2O2S4 |
| Molecular Weight | 350.56 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 5-[(3-ethylsulfanylcyclopentyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | CCSC1CCC(NS(=O)(=O)c2ccc(C(N)=S)s2)C1 |
| InChI | InChI=1S/C12H18N2O2S4/c1-2-18-9-4-3-8(7-9)14-20(15,16)11-6-5-10(19-11)12(13)17/h5-6,8-9,14H,2-4,7H2,1H3,(H2,13,17) |
| InChIKey | CAXUMRASZGTLJM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|