C13H21N3O2S3 — CID 106270897
5-[(1-ethylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270897) has the molecular formula C13H21N3O2S3 and a molecular weight of 347.53 g/mol. Its IUPAC name is 5-[(1-ethylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[(1-ethylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270897 |
| Molecular Formula | C13H21N3O2S3 |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-[(1-ethylpiperidin-4-yl)methylsulfamoyl]thiophene-2-carbothioamide |
| SMILES | CCN1CCC(CNS(=O)(=O)c2ccc(C(N)=S)s2)CC1 |
| InChI | InChI=1S/C13H21N3O2S3/c1-2-16-7-5-10(6-8-16)9-15-21(17,18)12-4-3-11(20-12)13(14)19/h3-4,10,15H,2,5-9H2,1H3,(H2,14,19) |
| InChIKey | KVKXFNWOLWIAEE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|