C12H16N2O4S3 — CID 106271625
methyl 1-(5-carbamothioylthiophen-2-yl)sulfonylpiperidine-3-carboxylate (PubChem CID 106271625) has the molecular formula C12H16N2O4S3 and a molecular weight of 348.47 g/mol. Its IUPAC name is methyl 1-(5-carbamothioylthiophen-2-yl)sulfonylpiperidine-3-carboxylate.
| Compound Name | methyl 1-(5-carbamothioylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 106271625 |
| Molecular Formula | C12H16N2O4S3 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 1-(5-carbamothioylthiophen-2-yl)sulfonylpiperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(S(=O)(=O)c2ccc(C(N)=S)s2)C1 |
| InChI | InChI=1S/C12H16N2O4S3/c1-18-12(15)8-3-2-6-14(7-8)21(16,17)10-5-4-9(20-10)11(13)19/h4-5,8H,2-3,6-7H2,1H3,(H2,13,19) |
| InChIKey | ANQLWRZJQTYTTM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|