C10H14N2O2S3 — CID 106270508
5-(2-methylpyrrolidin-1-yl)sulfonylthiophene-2-carbothioamide (PubChem CID 106270508) has the molecular formula C10H14N2O2S3 and a molecular weight of 290.44 g/mol. Its IUPAC name is 5-(2-methylpyrrolidin-1-yl)sulfonylthiophene-2-carbothioamide.
| Compound Name | 5-(2-methylpyrrolidin-1-yl)sulfonylthiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270508 |
| Molecular Formula | C10H14N2O2S3 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 5-(2-methylpyrrolidin-1-yl)sulfonylthiophene-2-carbothioamide |
| SMILES | CC1CCCN1S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C10H14N2O2S3/c1-7-3-2-6-12(7)17(13,14)9-5-4-8(16-9)10(11)15/h4-5,7H,2-3,6H2,1H3,(H2,11,15) |
| InChIKey | DIAXCVJNIHTCQJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|