C12H18N2O2S3 — CID 106271931
5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylthiophene-2-carbothioamide (PubChem CID 106271931) has the molecular formula C12H18N2O2S3 and a molecular weight of 318.49 g/mol. Its IUPAC name is 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylthiophene-2-carbothioamide.
| Compound Name | 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylthiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106271931 |
| Molecular Formula | C12H18N2O2S3 |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylthiophene-2-carbothioamide |
| SMILES | C[C@@H]1CCC[C@H](C)N1S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C12H18N2O2S3/c1-8-4-3-5-9(2)14(8)19(15,16)11-7-6-10(18-11)12(13)17/h6-9H,3-5H2,1-2H3,(H2,13,17)/t8-,9+ |
| InChIKey | YUUJNQAUBQWMSX-DTORHVGOSA-N |
| XLogP | 2.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|