C15H22N2O2S2 — CID 106920409
4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-2-methylbenzenecarbothioamide (PubChem CID 106920409) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-2-methylbenzenecarbothioamide.
| Compound Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-2-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 106920409 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonyl-2-methylbenzenecarbothioamide |
| SMILES | Cc1cc(S(=O)(=O)N2[C@H](C)CCC[C@@H]2C)ccc1C(N)=S |
| InChI | InChI=1S/C15H22N2O2S2/c1-10-9-13(7-8-14(10)15(16)20)21(18,19)17-11(2)5-4-6-12(17)3/h7-9,11-12H,4-6H2,1-3H3,(H2,16,20)/t11-,12+ |
| InChIKey | ZTVMDQFEQPIYEX-TXEJJXNPSA-N |
| XLogP | 2.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|