C16H23NO4S — CID 1460101
ethyl 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 1460101) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is ethyl 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 1460101 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl 4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2[C@H](C)CCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C16H23NO4S/c1-4-21-16(18)14-8-10-15(11-9-14)22(19,20)17-12(2)6-5-7-13(17)3/h8-13H,4-7H2,1-3H3/t12-,13+ |
| InChIKey | RCJJPNGQXKFBMM-BETUJISGSA-N |
| XLogP | 2.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |