C11H16N2O3S3 — CID 106270447
5-[methyl(oxan-4-yl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270447) has the molecular formula C11H16N2O3S3 and a molecular weight of 320.46 g/mol. Its IUPAC name is 5-[methyl(oxan-4-yl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[methyl(oxan-4-yl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270447 |
| Molecular Formula | C11H16N2O3S3 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 5-[methyl(oxan-4-yl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(C1CCOCC1)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C11H16N2O3S3/c1-13(8-4-6-16-7-5-8)19(14,15)10-3-2-9(18-10)11(12)17/h2-3,8H,4-7H2,1H3,(H2,12,17) |
| InChIKey | GCVZKFBBTBDQAH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|