C9H14N2O4S4 — CID 106271507
5-[methyl(2-methylsulfonylethyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106271507) has the molecular formula C9H14N2O4S4 and a molecular weight of 342.49 g/mol. Its IUPAC name is 5-[methyl(2-methylsulfonylethyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[methyl(2-methylsulfonylethyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106271507 |
| Molecular Formula | C9H14N2O4S4 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 341.98 |
| IUPAC Name | 5-[methyl(2-methylsulfonylethyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C9H14N2O4S4/c1-11(5-6-18(2,12)13)19(14,15)8-4-3-7(17-8)9(10)16/h3-4H,5-6H2,1-2H3,(H2,10,16) |
| InChIKey | FFVOPMOHFKCRHG-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|