C9H14N2O3S3 — CID 114166607
5-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 114166607) has the molecular formula C9H14N2O3S3 and a molecular weight of 294.42 g/mol. Its IUPAC name is 5-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 114166607 |
| Molecular Formula | C9H14N2O3S3 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 5-[2-methoxyethyl(methyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | COCCN(C)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C9H14N2O3S3/c1-11(5-6-14-2)17(12,13)8-4-3-7(16-8)9(10)15/h3-4H,5-6H2,1-2H3,(H2,10,15) |
| InChIKey | UTQYUKJBLANVMO-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|