C12H17N3O3S3 — CID 106270582
5-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)sulfamoyl]thiophene-2-carbothioamide (PubChem CID 106270582) has the molecular formula C12H17N3O3S3 and a molecular weight of 347.49 g/mol. Its IUPAC name is 5-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)sulfamoyl]thiophene-2-carbothioamide.
| Compound Name | 5-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)sulfamoyl]thiophene-2-carbothioamide |
|---|---|
| PubChem CID | 106270582 |
| Molecular Formula | C12H17N3O3S3 |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 5-[methyl-(2-oxo-2-pyrrolidin-1-ylethyl)sulfamoyl]thiophene-2-carbothioamide |
| SMILES | CN(CC(=O)N1CCCC1)S(=O)(=O)c1ccc(C(N)=S)s1 |
| InChI | InChI=1S/C12H17N3O3S3/c1-14(8-10(16)15-6-2-3-7-15)21(17,18)11-5-4-9(20-11)12(13)19/h4-5H,2-3,6-8H2,1H3,(H2,13,19) |
| InChIKey | CGABPNIZBBGCRA-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|