C11H17Cl2N3O3S2 — CID 119401193
5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide;hydrochloride (PubChem CID 119401193) has the molecular formula C11H17Cl2N3O3S2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide;hydrochloride.
| Compound Name | 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119401193 |
| Molecular Formula | C11H17Cl2N3O3S2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 5-chloro-N-methyl-N-(2-oxo-2-piperazin-1-ylethyl)thiophene-2-sulfonamide;hydrochloride |
| SMILES | CN(CC(=O)N1CCNCC1)S(=O)(=O)c1ccc(Cl)s1.Cl |
| InChI | InChI=1S/C11H16ClN3O3S2.ClH/c1-14(8-10(16)15-6-4-13-5-7-15)20(17,18)11-3-2-9(12)19-11;/h2-3,13H,4-8H2,1H3;1H |
| InChIKey | MMMVDHNCENNEPY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |