C15H24ClN3O3S2 — CID 50775946
5-chloro-N-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-2-sulfonamide (PubChem CID 50775946) has the molecular formula C15H24ClN3O3S2 and a molecular weight of 393.96 g/mol. Its IUPAC name is 5-chloro-N-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 50775946 |
| Molecular Formula | C15H24ClN3O3S2 |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 5-chloro-N-(2-methylpropyl)-N-(3-oxo-3-piperazin-1-ylpropyl)thiophene-2-sulfonamide |
| SMILES | CC(C)CN(CCC(=O)N1CCNCC1)S(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H24ClN3O3S2/c1-12(2)11-19(24(21,22)15-4-3-13(16)23-15)8-5-14(20)18-9-6-17-7-10-18/h3-4,12,17H,5-11H2,1-2H3 |
| InChIKey | JFUVGIYBYNBBSN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |