C9H12ClN3O3S2 — CID 141150888
N-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carboxamide (PubChem CID 141150888) has the molecular formula C9H12ClN3O3S2 and a molecular weight of 309.80 g/mol. Its IUPAC name is N-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 141150888 |
| Molecular Formula | C9H12ClN3O3S2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | N-(5-chlorothiophen-2-yl)sulfonylpiperazine-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C9H12ClN3O3S2/c10-7-1-2-8(17-7)18(15,16)12-9(14)13-5-3-11-4-6-13/h1-2,11H,3-6H2,(H,12,14) |
| InChIKey | AFRVSNNGESYBEH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |