C11H17ClN2O3S2 — CID 44571804
5-chloro-N-[(1S)-2-hydroxy-1-piperidin-4-ylethyl]thiophene-2-sulfonamide (PubChem CID 44571804) has the molecular formula C11H17ClN2O3S2 and a molecular weight of 324.86 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-2-hydroxy-1-piperidin-4-ylethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(1S)-2-hydroxy-1-piperidin-4-ylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 44571804 |
| Molecular Formula | C11H17ClN2O3S2 |
| Molecular Weight | 324.86 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 5-chloro-N-[(1S)-2-hydroxy-1-piperidin-4-ylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(N[C@H](CO)C1CCNCC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17ClN2O3S2/c12-10-1-2-11(18-10)19(16,17)14-9(7-15)8-3-5-13-6-4-8/h1-2,8-9,13-15H,3-7H2/t9-/m1/s1 |
| InChIKey | MQTKLULUXAJSGA-SECBINFHSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.86 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |