C12H19ClN2O3S2 — CID 63869653
5-chloro-N-(3-piperidin-4-yloxypropyl)thiophene-2-sulfonamide (PubChem CID 63869653) has the molecular formula C12H19ClN2O3S2 and a molecular weight of 338.88 g/mol. Its IUPAC name is 5-chloro-N-(3-piperidin-4-yloxypropyl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(3-piperidin-4-yloxypropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 63869653 |
| Molecular Formula | C12H19ClN2O3S2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-chloro-N-(3-piperidin-4-yloxypropyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCOC1CCNCC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H19ClN2O3S2/c13-11-2-3-12(19-11)20(16,17)15-6-1-9-18-10-4-7-14-8-5-10/h2-3,10,14-15H,1,4-9H2 |
| InChIKey | HTEXBMCPPZRDHW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|