C6H7ClN2O3S2 — CID 68844992
2-amino-N-(5-chlorothiophen-2-yl)sulfonylacetamide (PubChem CID 68844992) has the molecular formula C6H7ClN2O3S2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-amino-N-(5-chlorothiophen-2-yl)sulfonylacetamide.
| Compound Name | 2-amino-N-(5-chlorothiophen-2-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 68844992 |
| Molecular Formula | C6H7ClN2O3S2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 2-amino-N-(5-chlorothiophen-2-yl)sulfonylacetamide |
| SMILES | NCC(=O)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C6H7ClN2O3S2/c7-4-1-2-6(13-4)14(11,12)9-5(10)3-8/h1-2H,3,8H2,(H,9,10) |
| InChIKey | HJVDYRJMNIEHJW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |