C8H9ClN2O2S3 — CID 2141687
1-(5-chlorothiophen-2-yl)sulfonyl-3-prop-2-enylthiourea (PubChem CID 2141687) has the molecular formula C8H9ClN2O2S3 and a molecular weight of 296.83 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-prop-2-enylthiourea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 2141687 |
| Molecular Formula | C8H9ClN2O2S3 |
| Molecular Weight | 296.83 g/mol |
| Exact Mass | 295.95 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H9ClN2O2S3/c1-2-5-10-8(14)11-16(12,13)7-4-3-6(9)15-7/h2-4H,1,5H2,(H2,10,11,14) |
| InChIKey | WJELHQDHWMZTPX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.83 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|