C12H16ClN3O2S3 — CID 8675773
4-(5-chlorothiophen-2-yl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 8675773) has the molecular formula C12H16ClN3O2S3 and a molecular weight of 365.93 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8675773 |
| Molecular Formula | C12H16ClN3O2S3 |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C12H16ClN3O2S3/c1-2-5-14-12(19)15-6-8-16(9-7-15)21(17,18)11-4-3-10(13)20-11/h2-4H,1,5-9H2,(H,14,19) |
| InChIKey | YOPDOERUVZKQNK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|