C18H21N3O2S2 — CID 42993067
4-naphthalen-2-ylsulfonyl-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 42993067) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-naphthalen-2-ylsulfonyl-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-naphthalen-2-ylsulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 42993067 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-naphthalen-2-ylsulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C18H21N3O2S2/c1-2-9-19-18(24)20-10-12-21(13-11-20)25(22,23)17-8-7-15-5-3-4-6-16(15)14-17/h2-8,14H,1,9-13H2,(H,19,24) |
| InChIKey | AWZZGKWHXRGZAJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|