C14H17Cl2N3O2S2 — CID 8745410
4-(2,5-dichlorophenyl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide (PubChem CID 8745410) has the molecular formula C14H17Cl2N3O2S2 and a molecular weight of 394.35 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide.
| Compound Name | 4-(2,5-dichlorophenyl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8745410 |
| Molecular Formula | C14H17Cl2N3O2S2 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfonyl-N-prop-2-enylpiperazine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H17Cl2N3O2S2/c1-2-5-17-14(22)18-6-8-19(9-7-18)23(20,21)13-10-11(15)3-4-12(13)16/h2-4,10H,1,5-9H2,(H,17,22) |
| InChIKey | GFHNBYZRSLOXGK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|