C9H14N2OS — CID 130628814
4-oxo-N-prop-2-enylpiperidine-1-carbothioamide (PubChem CID 130628814) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-oxo-N-prop-2-enylpiperidine-1-carbothioamide.
| Compound Name | 4-oxo-N-prop-2-enylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 130628814 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 4-oxo-N-prop-2-enylpiperidine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCC(=O)CC1 |
| InChI | InChI=1S/C9H14N2OS/c1-2-5-10-9(13)11-6-3-8(12)4-7-11/h2H,1,3-7H2,(H,10,13) |
| InChIKey | GNZZSEJDYFDEDV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|