C13H22N4S2 — CID 20788463
2-methyl-1-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide (PubChem CID 20788463) has the molecular formula C13H22N4S2 and a molecular weight of 298.48 g/mol. Its IUPAC name is 2-methyl-1-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide.
| Compound Name | 2-methyl-1-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 20788463 |
| Molecular Formula | C13H22N4S2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-methyl-1-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
| SMILES | C=CCNC(=S)N1CCN(C(=S)NCC=C)C(C)C1 |
| InChI | InChI=1S/C13H22N4S2/c1-4-6-14-12(18)16-8-9-17(11(3)10-16)13(19)15-7-5-2/h4-5,11H,1-2,6-10H2,3H3,(H,14,18)(H,15,19) |
| InChIKey | WHLAFYAEFKUCFI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|