C11H20N2S — CID 51529124
(2S)-2-ethyl-N-prop-2-enylpiperidine-1-carbothioamide (PubChem CID 51529124) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is (2S)-2-ethyl-N-prop-2-enylpiperidine-1-carbothioamide.
| Compound Name | (2S)-2-ethyl-N-prop-2-enylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 51529124 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (2S)-2-ethyl-N-prop-2-enylpiperidine-1-carbothioamide |
| SMILES | C=CCNC(=S)N1CCCC[C@@H]1CC |
| InChI | InChI=1S/C11H20N2S/c1-3-8-12-11(14)13-9-6-5-7-10(13)4-2/h3,10H,1,4-9H2,2H3,(H,12,14)/t10-/m0/s1 |
| InChIKey | GWNRHINOCWJIIS-JTQLQIEISA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|