C15H20F2N2S2 — CID 2372905
(2R)-N-[4-(difluoromethylsulfanyl)phenyl]-2-ethylpiperidine-1-carbothioamide (PubChem CID 2372905) has the molecular formula C15H20F2N2S2 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R)-N-[4-(difluoromethylsulfanyl)phenyl]-2-ethylpiperidine-1-carbothioamide.
| Compound Name | (2R)-N-[4-(difluoromethylsulfanyl)phenyl]-2-ethylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 2372905 |
| Molecular Formula | C15H20F2N2S2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2R)-N-[4-(difluoromethylsulfanyl)phenyl]-2-ethylpiperidine-1-carbothioamide |
| SMILES | CC[C@@H]1CCCCN1C(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H20F2N2S2/c1-2-12-5-3-4-10-19(12)15(20)18-11-6-8-13(9-7-11)21-14(16)17/h6-9,12,14H,2-5,10H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | YQWOXKDXMBLRCK-GFCCVEGCSA-N |
| XLogP | 4.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|