C14H18F2N2S2 — CID 2372693
N-[4-(difluoromethylsulfanyl)phenyl]azepane-1-carbothioamide (PubChem CID 2372693) has the molecular formula C14H18F2N2S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]azepane-1-carbothioamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]azepane-1-carbothioamide |
|---|---|
| PubChem CID | 2372693 |
| Molecular Formula | C14H18F2N2S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]azepane-1-carbothioamide |
| SMILES | FC(F)Sc1ccc(NC(=S)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C14H18F2N2S2/c15-13(16)20-12-7-5-11(6-8-12)17-14(19)18-9-3-1-2-4-10-18/h5-8,13H,1-4,9-10H2,(H,17,19) |
| InChIKey | IEGWVNNVLREEDW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|