C15H19F2N3O2S2 — CID 8626453
ethyl 4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazine-1-carboxylate (PubChem CID 8626453) has the molecular formula C15H19F2N3O2S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 8626453 |
| Molecular Formula | C15H19F2N3O2S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | ethyl 4-[[4-(difluoromethylsulfanyl)phenyl]carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)Nc2ccc(SC(F)F)cc2)CC1 |
| InChI | InChI=1S/C15H19F2N3O2S2/c1-2-22-15(21)20-9-7-19(8-10-20)14(23)18-11-3-5-12(6-4-11)24-13(16)17/h3-6,13H,2,7-10H2,1H3,(H,18,23) |
| InChIKey | SBFNDZHZZZUOMP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|