C14H18BrN3O2S — CID 1315067
ethyl 4-[(4-bromophenyl)carbamothioyl]piperazine-1-carboxylate (PubChem CID 1315067) has the molecular formula C14H18BrN3O2S and a molecular weight of 372.29 g/mol. Its IUPAC name is ethyl 4-[(4-bromophenyl)carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(4-bromophenyl)carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 1315067 |
| Molecular Formula | C14H18BrN3O2S |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | ethyl 4-[(4-bromophenyl)carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C14H18BrN3O2S/c1-2-20-14(19)18-9-7-17(8-10-18)13(21)16-12-5-3-11(15)4-6-12/h3-6H,2,7-10H2,1H3,(H,16,21) |
| InChIKey | NQZRRLCWEMNPED-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|