C16H24N4O2S — CID 23827878
ethyl 4-[[4-(dimethylamino)phenyl]carbamothioyl]piperazine-1-carboxylate (PubChem CID 23827878) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is ethyl 4-[[4-(dimethylamino)phenyl]carbamothioyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[4-(dimethylamino)phenyl]carbamothioyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23827878 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl 4-[[4-(dimethylamino)phenyl]carbamothioyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)Nc2ccc(N(C)C)cc2)CC1 |
| InChI | InChI=1S/C16H24N4O2S/c1-4-22-16(21)20-11-9-19(10-12-20)15(23)17-13-5-7-14(8-6-13)18(2)3/h5-8H,4,9-12H2,1-3H3,(H,17,23) |
| InChIKey | DZQNPVRNRZDRFV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|