C15H18N4O3S — CID 126201367
ethyl 4-(2,1-benzoxazol-6-ylcarbamothioyl)piperazine-1-carboxylate (PubChem CID 126201367) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is ethyl 4-(2,1-benzoxazol-6-ylcarbamothioyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(2,1-benzoxazol-6-ylcarbamothioyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126201367 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | ethyl 4-(2,1-benzoxazol-6-ylcarbamothioyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=S)Nc2ccc3conc3c2)CC1 |
| InChI | InChI=1S/C15H18N4O3S/c1-2-21-15(20)19-7-5-18(6-8-19)14(23)16-12-4-3-11-10-22-17-13(11)9-12/h3-4,9-10H,2,5-8H2,1H3,(H,16,23) |
| InChIKey | POEZRTLELTXNOP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|