C20H29N5O2S — CID 56613102
ethyl 2-tert-butyl-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate (PubChem CID 56613102) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is ethyl 2-tert-butyl-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate.
| Compound Name | ethyl 2-tert-butyl-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 56613102 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | ethyl 2-tert-butyl-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(C)(C)C)nc2ccc(NC(=S)N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C20H29N5O2S/c1-6-27-19(26)25-16-13-14(7-8-15(16)22-17(25)20(2,3)4)21-18(28)24-11-9-23(5)10-12-24/h7-8,13H,6,9-12H2,1-5H3,(H,21,28) |
| InChIKey | WZOJULHWKCPZRR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|