C21H31N5O3S — CID 56608325
ethyl 2-tert-butyl-5-methoxy-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate (PubChem CID 56608325) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is ethyl 2-tert-butyl-5-methoxy-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate.
| Compound Name | ethyl 2-tert-butyl-5-methoxy-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 56608325 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | ethyl 2-tert-butyl-5-methoxy-6-[(4-methylpiperazine-1-carbothioyl)amino]benzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C(C)(C)C)nc2cc(OC)c(NC(=S)N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C21H31N5O3S/c1-7-29-20(27)26-16-12-15(23-19(30)25-10-8-24(5)9-11-25)17(28-6)13-14(16)22-18(26)21(2,3)4/h12-13H,7-11H2,1-6H3,(H,23,30) |
| InChIKey | HWPYFHABVIKYDC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|